C24H34I2N4O4 — CID 53472810
2-[[4,8-dihydroxy-9,10-dioxo-5-[2-(trimethylazaniumyl)ethylamino]anthracen-1-yl]amino]ethyl-trimethylazanium diiodide (PubChem CID 53472810) has the molecular formula C24H34I2N4O4 and a molecular weight of 696.37 g/mol. Its IUPAC name is 2-[[4,8-dihydroxy-9,10-dioxo-5-[2-(trimethylazaniumyl)ethylamino]anthracen-1-yl]amino]ethyl-trimethylazanium diiodide.
| Compound Name | 2-[[4,8-dihydroxy-9,10-dioxo-5-[2-(trimethylazaniumyl)ethylamino]anthracen-1-yl]amino]ethyl-trimethylazanium diiodide |
|---|---|
| PubChem CID | 53472810 |
| Molecular Formula | C24H34I2N4O4 |
| Molecular Weight | 696.37 g/mol |
| Exact Mass | 696.07 |
| IUPAC Name | 2-[[4,8-dihydroxy-9,10-dioxo-5-[2-(trimethylazaniumyl)ethylamino]anthracen-1-yl]amino]ethyl-trimethylazanium diiodide |
| SMILES | C[N+](C)(C)CCNc1ccc(O)c2c1C(=O)c1c(O)ccc(NCC[N+](C)(C)C)c1C2=O.[I-].[I-] |
| InChI | InChI=1S/C24H32N4O4.2HI/c1-27(2,3)13-11-25-15-7-9-17(29)21-19(15)23(31)22-18(30)10-8-16(20(22)24(21)32)26-12-14-28(4,5)6;;/h7-10H,11-14H2,1-6H3,(H2-2,25,26,29,30,31,32);2*1H |
| InChIKey | XVZXPIGOOUHBKS-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.37 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|