C24H26F6N4O6 — CID 11621192
N-[2-[[5,8-dihydroxy-4-[2-[methyl-oxido-(2,2,2-trifluoroethyl)azaniumyl]ethylamino]-9,10-dioxoanthracen-1-yl]amino]ethyl]-2,2,2-trifluoro-N-methylethanamine oxide (PubChem CID 11621192) has the molecular formula C24H26F6N4O6 and a molecular weight of 580.48 g/mol. Its IUPAC name is N-[2-[[5,8-dihydroxy-4-[2-[methyl-oxido-(2,2,2-trifluoroethyl)azaniumyl]ethylamino]-9,10-dioxoanthracen-1-yl]amino]ethyl]-2,2,2-trifluoro-N-methylethanamine oxide.
| Compound Name | N-[2-[[5,8-dihydroxy-4-[2-[methyl-oxido-(2,2,2-trifluoroethyl)azaniumyl]ethylamino]-9,10-dioxoanthracen-1-yl]amino]ethyl]-2,2,2-trifluoro-N-methylethanamine oxide |
|---|---|
| PubChem CID | 11621192 |
| Molecular Formula | C24H26F6N4O6 |
| Molecular Weight | 580.48 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | N-[2-[[5,8-dihydroxy-4-[2-[methyl-oxido-(2,2,2-trifluoroethyl)azaniumyl]ethylamino]-9,10-dioxoanthracen-1-yl]amino]ethyl]-2,2,2-trifluoro-N-methylethanamine oxide |
| SMILES | C[N+]([O-])(CCNc1ccc(NCC[N+](C)([O-])CC(F)(F)F)c2c1C(=O)c1c(O)ccc(O)c1C2=O)CC(F)(F)F |
| InChI | InChI=1S/C24H26F6N4O6/c1-33(39,11-23(25,26)27)9-7-31-13-3-4-14(32-8-10-34(2,40)12-24(28,29)30)18-17(13)21(37)19-15(35)5-6-16(36)20(19)22(18)38/h3-6,31-32,35-36H,7-12H2,1-2H3 |
| InChIKey | IANLYZAYMBMXLH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|