C16H12N2O7 — CID 134486690
1,8-dihydroxy-4-(2-hydroxyethylamino)-5-nitroanthracene-9,10-dione (PubChem CID 134486690) has the molecular formula C16H12N2O7 and a molecular weight of 344.28 g/mol. Its IUPAC name is 1,8-dihydroxy-4-(2-hydroxyethylamino)-5-nitroanthracene-9,10-dione.
| Compound Name | 1,8-dihydroxy-4-(2-hydroxyethylamino)-5-nitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 134486690 |
| Molecular Formula | C16H12N2O7 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1,8-dihydroxy-4-(2-hydroxyethylamino)-5-nitroanthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(NCCO)c2C(=O)c2c([N+](=O)[O-])ccc(O)c21 |
| InChI | InChI=1S/C16H12N2O7/c19-6-5-17-7-1-3-9(20)13-11(7)15(22)12-8(18(24)25)2-4-10(21)14(12)16(13)23/h1-4,17,19-21H,5-6H2 |
| InChIKey | JZCSSQDSDOSHSG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|