C26H17N3O5 — CID 14597507
1,4-dianilino-5-hydroxy-8-nitroanthracene-9,10-dione (PubChem CID 14597507) has the molecular formula C26H17N3O5 and a molecular weight of 451.44 g/mol. Its IUPAC name is 1,4-dianilino-5-hydroxy-8-nitroanthracene-9,10-dione.
| Compound Name | 1,4-dianilino-5-hydroxy-8-nitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 14597507 |
| Molecular Formula | C26H17N3O5 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 1,4-dianilino-5-hydroxy-8-nitroanthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc([N+](=O)[O-])c2C(=O)c2c(Nc3ccccc3)ccc(Nc3ccccc3)c21 |
| InChI | InChI=1S/C26H17N3O5/c30-20-14-13-19(29(33)34)23-24(20)26(32)22-18(28-16-9-5-2-6-10-16)12-11-17(21(22)25(23)31)27-15-7-3-1-4-8-15/h1-14,27-28,30H |
| InChIKey | GGQADPAYPSXAMP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|