C34H29N3O8 — CID 143011553
2-[4-[(4,5-dihydroxy-8-nitro-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl N-[1-(3-prop-1-en-2-ylphenyl)ethyl]carbamate (PubChem CID 143011553) has the molecular formula C34H29N3O8 and a molecular weight of 607.62 g/mol. Its IUPAC name is 2-[4-[(4,5-dihydroxy-8-nitro-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl N-[1-(3-prop-1-en-2-ylphenyl)ethyl]carbamate.
| Compound Name | 2-[4-[(4,5-dihydroxy-8-nitro-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl N-[1-(3-prop-1-en-2-ylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 143011553 |
| Molecular Formula | C34H29N3O8 |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | 2-[4-[(4,5-dihydroxy-8-nitro-9,10-dioxoanthracen-1-yl)amino]phenyl]ethyl N-[1-(3-prop-1-en-2-ylphenyl)ethyl]carbamate |
| SMILES | C=C(C)c1cccc(C(C)NC(=O)OCCc2ccc(Nc3ccc(O)c4c3C(=O)c3c([N+](=O)[O-])ccc(O)c3C4=O)cc2)c1 |
| InChI | InChI=1S/C34H29N3O8/c1-18(2)21-5-4-6-22(17-21)19(3)35-34(42)45-16-15-20-7-9-23(10-8-20)36-24-11-13-26(38)30-28(24)32(40)29-25(37(43)44)12-14-27(39)31(29)33(30)41/h4-14,17,19,36,38-39H,1,15-16H2,2-3H3,(H,35,42) |
| InChIKey | RKCUMIFNZVJXHS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|