C22H16N2O7 — CID 174817201
1,2-dihydroxy-4-[4-(2-hydroxyethyl)anilino]-5-nitroanthracene-9,10-dione (PubChem CID 174817201) has the molecular formula C22H16N2O7 and a molecular weight of 420.38 g/mol. Its IUPAC name is 1,2-dihydroxy-4-[4-(2-hydroxyethyl)anilino]-5-nitroanthracene-9,10-dione.
| Compound Name | 1,2-dihydroxy-4-[4-(2-hydroxyethyl)anilino]-5-nitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 174817201 |
| Molecular Formula | C22H16N2O7 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1,2-dihydroxy-4-[4-(2-hydroxyethyl)anilino]-5-nitroanthracene-9,10-dione |
| SMILES | O=C1c2c(cccc2[N+](=O)[O-])C(=O)c2c(O)c(O)cc(Nc3ccc(CCO)cc3)c21 |
| InChI | InChI=1S/C22H16N2O7/c25-9-8-11-4-6-12(7-5-11)23-14-10-16(26)21(28)19-18(14)22(29)17-13(20(19)27)2-1-3-15(17)24(30)31/h1-7,10,23,25-26,28H,8-9H2 |
| InChIKey | UBQFRUCKMFQTHC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|