C16H12N2O7 — CID 159527606
1,8-dinitroanthracene-9,10-dione;ethanol (PubChem CID 159527606) has the molecular formula C16H12N2O7 and a molecular weight of 344.28 g/mol. Its IUPAC name is 1,8-dinitroanthracene-9,10-dione;ethanol.
| Compound Name | 1,8-dinitroanthracene-9,10-dione;ethanol |
|---|---|
| PubChem CID | 159527606 |
| Molecular Formula | C16H12N2O7 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1,8-dinitroanthracene-9,10-dione;ethanol |
| SMILES | CCO.O=C1c2cccc([N+](=O)[O-])c2C(=O)c2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C14H6N2O6.C2H6O/c17-13-7-3-1-5-9(15(19)20)11(7)14(18)12-8(13)4-2-6-10(12)16(21)22;1-2-3/h1-6H;3H,2H2,1H3 |
| InChIKey | MCORSUXQEQLKNR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|