C8H4N2O4 — CID 11779
4-nitroisoindole-1,3-dione (PubChem CID 11779) has the molecular formula C8H4N2O4 and a molecular weight of 192.13 g/mol. Its IUPAC name is 4-nitroisoindole-1,3-dione.
| Compound Name | 4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11779 |
| Molecular Formula | C8H4N2O4 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 4-nitroisoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C8H4N2O4/c11-7-4-2-1-3-5(10(13)14)6(4)8(12)9-7/h1-3H,(H,9,11,12) |
| InChIKey | BONIIQYTWOPUQI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|