C8H9N3O3 — CID 172812376
hydrazine;4-hydroxyisoindole-1,3-dione (PubChem CID 172812376) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is hydrazine;4-hydroxyisoindole-1,3-dione.
| Compound Name | hydrazine;4-hydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 172812376 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | hydrazine;4-hydroxyisoindole-1,3-dione |
| SMILES | NN.O=C1NC(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C8H5NO3.H4N2/c10-5-3-1-2-4-6(5)8(12)9-7(4)11;1-2/h1-3,10H,(H,9,11,12);1-2H2 |
| InChIKey | SIWBQZUJDQFCFH-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|