C24H15NO4 — CID 11291966
4,9-bis(2-hydroxyphenyl)benzo[f]isoindole-1,3-dione (PubChem CID 11291966) has the molecular formula C24H15NO4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 4,9-bis(2-hydroxyphenyl)benzo[f]isoindole-1,3-dione.
| Compound Name | 4,9-bis(2-hydroxyphenyl)benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11291966 |
| Molecular Formula | C24H15NO4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 4,9-bis(2-hydroxyphenyl)benzo[f]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1c(-c1ccccc1O)c1ccccc1c2-c1ccccc1O |
| InChI | InChI=1S/C24H15NO4/c26-17-11-5-3-9-15(17)19-13-7-1-2-8-14(13)20(16-10-4-6-12-18(16)27)22-21(19)23(28)25-24(22)29/h1-12,26-27H,(H,25,28,29) |
| InChIKey | PWHGRXAJSVSRDS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|