C13H9NO2 — CID 132606674
5-methylbenzo[e]isoindole-1,3-dione (PubChem CID 132606674) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-methylbenzo[e]isoindole-1,3-dione.
| Compound Name | 5-methylbenzo[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 132606674 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 5-methylbenzo[e]isoindole-1,3-dione |
| SMILES | Cc1cc2c(c3ccccc13)C(=O)NC2=O |
| InChI | InChI=1S/C13H9NO2/c1-7-6-10-11(13(16)14-12(10)15)9-5-3-2-4-8(7)9/h2-6H,1H3,(H,14,15,16) |
| InChIKey | XELJLEHTFCQPBH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|