About naphtho[2,1-e]isoindole-1,3-dione
naphtho[2,1-e]isoindole-1,3-dione (PubChem CID 87830454) has the molecular formula C16H9NO2
and a molecular weight of 247.25 g/mol. Its IUPAC name is naphtho[2,1-e]isoindole-1,3-dione.
Molecular Properties
| Compound Name | naphtho[2,1-e]isoindole-1,3-dione |
| PubChem CID | 87830454 |
| Molecular Formula | C16H9NO2 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | naphtho[2,1-e]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C16H9NO2/c18-15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16(19)17-15/h1-8H,(H,17,18,19) |
| InChIKey | PIXICFMFSJMSJM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze naphtho[2,1-e]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[2,1-e]isoindole-1,3-dione?
The IUPAC name of naphtho[2,1-e]isoindole-1,3-dione (CID 87830454) is naphtho[2,1-e]isoindole-1,3-dione.
What is the SMILES notation for naphtho[2,1-e]isoindole-1,3-dione?
The canonical SMILES for naphtho[2,1-e]isoindole-1,3-dione is O=C1NC(=O)c2c1ccc1c2ccc2ccccc21.
What is the InChIKey of naphtho[2,1-e]isoindole-1,3-dione?
The InChIKey is PIXICFMFSJMSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO2/c18-15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16(19)17-15/h1-8H,(H,17,18,19).
What are the key properties of naphtho[2,1-e]isoindole-1,3-dione?
naphtho[2,1-e]isoindole-1,3-dione has a molecular weight of 247.25 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[2,1-e]isoindole-1,3-dione is sourced from PubChem (CID 87830454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).