C25H20O2 — CID 118066168
9,12,12,15-tetramethylpentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),5,9,14,16,18,20-nonaene-4,7-dione (PubChem CID 118066168) has the molecular formula C25H20O2 and a molecular weight of 352.43 g/mol. Its IUPAC name is 9,12,12,15-tetramethylpentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),5,9,14,16,18,20-nonaene-4,7-dione.
| Compound Name | 9,12,12,15-tetramethylpentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),5,9,14,16,18,20-nonaene-4,7-dione |
|---|---|
| PubChem CID | 118066168 |
| Molecular Formula | C25H20O2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 9,12,12,15-tetramethylpentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),5,9,14,16,18,20-nonaene-4,7-dione |
| SMILES | Cc1cc2c(c3c1C(=O)C=CC3=O)-c1c(cc(C)c3ccccc13)C2(C)C |
| InChI | InChI=1S/C25H20O2/c1-13-11-17-22(16-8-6-5-7-15(13)16)23-18(25(17,3)4)12-14(2)21-19(26)9-10-20(27)24(21)23/h5-12H,1-4H3 |
| InChIKey | ZWZBNBUPZOIPRO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|