C30H31BO2 — CID 58479663
4,4,5,5-tetramethyl-2-(12,12,15-trimethyl-9-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaenyl)-1,3,2-dioxaborolane (PubChem CID 58479663) has the molecular formula C30H31BO2 and a molecular weight of 434.39 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(12,12,15-trimethyl-9-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(12,12,15-trimethyl-9-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58479663 |
| Molecular Formula | C30H31BO2 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(12,12,15-trimethyl-9-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaenyl)-1,3,2-dioxaborolane |
| SMILES | Cc1cc2c(c3ccccc13)-c1c(cc(B3OC(C)(C)C(C)(C)O3)c3ccccc13)C2(C)C |
| InChI | InChI=1S/C30H31BO2/c1-18-16-23-26(21-14-10-8-12-19(18)21)27-22-15-11-9-13-20(22)25(17-24(27)28(23,2)3)31-32-29(4,5)30(6,7)33-31/h8-17H,1-7H3 |
| InChIKey | RETJNSMBDCYJNJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|