C25H27BO2 — CID 140892174
2-(7,7-dimethylbenzo[c]fluoren-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 140892174) has the molecular formula C25H27BO2 and a molecular weight of 370.30 g/mol. Its IUPAC name is 2-(7,7-dimethylbenzo[c]fluoren-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(7,7-dimethylbenzo[c]fluoren-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140892174 |
| Molecular Formula | C25H27BO2 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-(7,7-dimethylbenzo[c]fluoren-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)c2ccccc2-c2c1cc(B1OC(C)(C)C(C)(C)O1)c1ccccc21 |
| InChI | InChI=1S/C25H27BO2/c1-23(2)19-14-10-9-13-18(19)22-17-12-8-7-11-16(17)21(15-20(22)23)26-27-24(3,4)25(5,6)28-26/h7-15H,1-6H3 |
| InChIKey | JGCKUGBZEXUSKL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|