C37H36BNO2 — CID 123886768
9,9-dimethyl-N-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]fluoren-2-amine (PubChem CID 123886768) has the molecular formula C37H36BNO2 and a molecular weight of 537.51 g/mol. Its IUPAC name is 9,9-dimethyl-N-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]fluoren-2-amine |
|---|---|
| PubChem CID | 123886768 |
| Molecular Formula | C37H36BNO2 |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 9,9-dimethyl-N-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccccc3)c3ccc(B4OC(C)(C)C(C)(C)O4)c4ccccc34)cc21 |
| InChI | InChI=1S/C37H36BNO2/c1-35(2)31-19-13-12-16-27(31)28-21-20-26(24-32(28)35)39(25-14-8-7-9-15-25)34-23-22-33(29-17-10-11-18-30(29)34)38-40-36(3,4)37(5,6)41-38/h7-24H,1-6H3 |
| InChIKey | ISYPOZQJZDUUMK-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|