C45H40BNO3 — CID 154697052
N-(9,9-dimethylfluoren-2-yl)-N-(4-phenylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-amine (PubChem CID 154697052) has the molecular formula C45H40BNO3 and a molecular weight of 653.63 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-N-(4-phenylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-N-(4-phenylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 154697052 |
| Molecular Formula | C45H40BNO3 |
| Molecular Weight | 653.63 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-N-(4-phenylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3cccc4c3oc3c(B5OC(C)(C)C(C)(C)O5)cccc34)cc21 |
| InChI | InChI=1S/C45H40BNO3/c1-43(2)37-19-11-10-16-33(37)34-27-26-32(28-38(34)43)47(31-24-22-30(23-25-31)29-14-8-7-9-15-29)40-21-13-18-36-35-17-12-20-39(41(35)48-42(36)40)46-49-44(3,4)45(5,6)50-46/h7-28H,1-6H3 |
| InChIKey | QVGFEMZLNDSNMM-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.63 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|