C45H42BNO2 — CID 166590872
9,9-dimethyl-N-[4-(4-phenylphenyl)phenyl]-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]fluoren-2-amine (PubChem CID 166590872) has the molecular formula C45H42BNO2 and a molecular weight of 639.65 g/mol. Its IUPAC name is 9,9-dimethyl-N-[4-(4-phenylphenyl)phenyl]-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[4-(4-phenylphenyl)phenyl]-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 166590872 |
| Molecular Formula | C45H42BNO2 |
| Molecular Weight | 639.65 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | 9,9-dimethyl-N-[4-(4-phenylphenyl)phenyl]-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3ccc(-c4ccc(-c5ccccc5)cc4)cc3)cc21 |
| InChI | InChI=1S/C45H42BNO2/c1-43(2)41-15-11-10-14-39(41)40-29-28-38(30-42(40)43)47(37-26-22-35(23-27-37)46-48-44(3,4)45(5,6)49-46)36-24-20-34(21-25-36)33-18-16-32(17-19-33)31-12-8-7-9-13-31/h7-30H,1-6H3 |
| InChIKey | IPRCXNGLQWKNIC-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.65 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|