C63H60B2N2O4 — CID 164787642
N-[4-[4-[3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 164787642) has the molecular formula C63H60B2N2O4 and a molecular weight of 930.81 g/mol. Its IUPAC name is N-[4-[4-[3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | N-[4-[4-[3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 164787642 |
| Molecular Formula | C63H60B2N2O4 |
| Molecular Weight | 930.81 g/mol |
| Exact Mass | 930.47 |
| IUPAC Name | N-[4-[4-[3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccc(-n5c6ccc(B7OC(C)(C)C(C)(C)O7)cc6c6cc(B7OC(C)(C)C(C)(C)O7)ccc65)cc4)cc3)cc21 |
| InChI | InChI=1S/C63H60B2N2O4/c1-59(2)55-19-15-14-18-51(55)52-35-34-50(40-56(52)59)66(47-28-20-42(21-29-47)41-16-12-11-13-17-41)48-30-22-43(23-31-48)44-24-32-49(33-25-44)67-57-36-26-45(64-68-60(3,4)61(5,6)69-64)38-53(57)54-39-46(27-37-58(54)67)65-70-62(7,8)63(9,10)71-65/h11-40H,1-10H3 |
| InChIKey | ZDRXLWNSBFJGFC-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.81 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|