C25H26BBrO2 — CID 143729801
2-(9-bromo-7,7-dimethylbenzo[c]fluoren-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 143729801) has the molecular formula C25H26BBrO2 and a molecular weight of 449.20 g/mol. Its IUPAC name is 2-(9-bromo-7,7-dimethylbenzo[c]fluoren-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(9-bromo-7,7-dimethylbenzo[c]fluoren-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 143729801 |
| Molecular Formula | C25H26BBrO2 |
| Molecular Weight | 449.20 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-(9-bromo-7,7-dimethylbenzo[c]fluoren-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)c2cc(Br)ccc2-c2c1cc(B1OC(C)(C)C(C)(C)O1)c1ccccc21 |
| InChI | InChI=1S/C25H26BBrO2/c1-23(2)19-13-15(27)11-12-18(19)22-17-10-8-7-9-16(17)21(14-20(22)23)26-28-24(3,4)25(5,6)29-26/h7-14H,1-6H3 |
| InChIKey | WUFYKYCFJLJKIF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.20 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|