C33H33BO2 — CID 153370184
2-[3-[4-(9,9-dimethylfluoren-4-yl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 153370184) has the molecular formula C33H33BO2 and a molecular weight of 472.44 g/mol. Its IUPAC name is 2-[3-[4-(9,9-dimethylfluoren-4-yl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-[4-(9,9-dimethylfluoren-4-yl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 153370184 |
| Molecular Formula | C33H33BO2 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-[3-[4-(9,9-dimethylfluoren-4-yl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)c2ccccc2-c2c(-c3ccc(-c4cccc(B5OC(C)(C)C(C)(C)O5)c4)cc3)cccc21 |
| InChI | InChI=1S/C33H33BO2/c1-31(2)28-15-8-7-13-27(28)30-26(14-10-16-29(30)31)23-19-17-22(18-20-23)24-11-9-12-25(21-24)34-35-32(3,4)33(5,6)36-34/h7-21H,1-6H3 |
| InChIKey | MGCGCTMNEKOQFP-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|