C48H41BO2 — CID 123477261
4,4,5,5-tetramethyl-2-[3-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]phenyl]phenyl]-1,3,2-dioxaborolane (PubChem CID 123477261) has the molecular formula C48H41BO2 and a molecular weight of 660.67 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]phenyl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]phenyl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123477261 |
| Molecular Formula | C48H41BO2 |
| Molecular Weight | 660.67 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]phenyl]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cccc(-c3cccc(-c4cccc(-c5cccc(-c6cccc(-c7cccc(-c8ccccc8)c7)c6)c5)c4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C48H41BO2/c1-47(2)48(3,4)51-49(50-47)46-27-13-26-45(33-46)44-25-12-24-43(32-44)42-23-11-22-41(31-42)40-21-10-20-39(30-40)38-19-9-18-37(29-38)36-17-8-16-35(28-36)34-14-6-5-7-15-34/h5-33H,1-4H3 |
| InChIKey | SKDAKRHOQPBLBK-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.67 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|