C28H27BO2 — CID 162429693
4,4,5,5-tetramethyl-2-[3-(4-phenylnaphthalen-1-yl)phenyl]-1,3,2-dioxaborolane (PubChem CID 162429693) has the molecular formula C28H27BO2 and a molecular weight of 406.33 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-(4-phenylnaphthalen-1-yl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-(4-phenylnaphthalen-1-yl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162429693 |
| Molecular Formula | C28H27BO2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-(4-phenylnaphthalen-1-yl)phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cccc(-c3ccc(-c4ccccc4)c4ccccc34)c2)OC1(C)C |
| InChI | InChI=1S/C28H27BO2/c1-27(2)28(3,4)31-29(30-27)22-14-10-13-21(19-22)24-18-17-23(20-11-6-5-7-12-20)25-15-8-9-16-26(24)25/h5-19H,1-4H3 |
| InChIKey | XTGYLFJOACRQDM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|