C42H37BO2 — CID 140796929
2-[3-(3,5-diphenylphenyl)-5-(3-phenylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 140796929) has the molecular formula C42H37BO2 and a molecular weight of 584.57 g/mol. Its IUPAC name is 2-[3-(3,5-diphenylphenyl)-5-(3-phenylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(3,5-diphenylphenyl)-5-(3-phenylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140796929 |
| Molecular Formula | C42H37BO2 |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 2-[3-(3,5-diphenylphenyl)-5-(3-phenylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(-c3cccc(-c4ccccc4)c3)cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C42H37BO2/c1-41(2)42(3,4)45-43(44-41)40-28-38(34-22-14-21-33(23-34)30-15-8-5-9-16-30)27-39(29-40)37-25-35(31-17-10-6-11-18-31)24-36(26-37)32-19-12-7-13-20-32/h5-29H,1-4H3 |
| InChIKey | ORWUYNLOFRMNAR-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|