C35H39B2NO4 — CID 70847694
4-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenylpyridine (PubChem CID 70847694) has the molecular formula C35H39B2NO4 and a molecular weight of 559.32 g/mol. Its IUPAC name is 4-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenylpyridine.
| Compound Name | 4-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 70847694 |
| Molecular Formula | C35H39B2NO4 |
| Molecular Weight | 559.32 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 4-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenylpyridine |
| SMILES | CC1(C)OB(c2cc(B3OC(C)(C)C(C)(C)O3)cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C35H39B2NO4/c1-32(2)33(3,4)40-36(39-32)28-19-26(20-29(23-28)37-41-34(5,6)35(7,8)42-37)27-21-30(24-15-11-9-12-16-24)38-31(22-27)25-17-13-10-14-18-25/h9-23H,1-8H3 |
| InChIKey | XDENQFPIGLMSKA-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.32 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|