C34H38B2N2O4 — CID 59188592
2-phenyl-4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine (PubChem CID 59188592) has the molecular formula C34H38B2N2O4 and a molecular weight of 560.31 g/mol. Its IUPAC name is 2-phenyl-4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine.
| Compound Name | 2-phenyl-4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 59188592 |
| Molecular Formula | C34H38B2N2O4 |
| Molecular Weight | 560.31 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 2-phenyl-4,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
| SMILES | CC1(C)OB(c2ccc(-c3cc(-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)nc(-c4ccccc4)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C34H38B2N2O4/c1-31(2)32(3,4)40-35(39-31)26-18-14-23(15-19-26)28-22-29(38-30(37-28)25-12-10-9-11-13-25)24-16-20-27(21-17-24)36-41-33(5,6)34(7,8)42-36/h9-22H,1-8H3 |
| InChIKey | ITTSUHSRVCVFPC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.31 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|