C34H33BN2O2 — CID 177242684
4-(3-cyclohexa-1,5-dien-1-ylphenyl)-6-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine (PubChem CID 177242684) has the molecular formula C34H33BN2O2 and a molecular weight of 512.46 g/mol. Its IUPAC name is 4-(3-cyclohexa-1,5-dien-1-ylphenyl)-6-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine.
| Compound Name | 4-(3-cyclohexa-1,5-dien-1-ylphenyl)-6-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 177242684 |
| Molecular Formula | C34H33BN2O2 |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 4-(3-cyclohexa-1,5-dien-1-ylphenyl)-6-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
| SMILES | CC1(C)OB(c2ccc(-c3nc(-c4ccccc4)cc(-c4cccc(C5=CCCC=C5)c4)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C34H33BN2O2/c1-33(2)34(3,4)39-35(38-33)29-20-18-26(19-21-29)32-36-30(25-14-9-6-10-15-25)23-31(37-32)28-17-11-16-27(22-28)24-12-7-5-8-13-24/h6-7,9-23H,5,8H2,1-4H3 |
| InChIKey | OORVIRLSAMHPPW-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|