C54H50B2N2O4 — CID 58789449
4-phenyl-6-[4-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinolin-6-yl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline (PubChem CID 58789449) has the molecular formula C54H50B2N2O4 and a molecular weight of 812.63 g/mol. Its IUPAC name is 4-phenyl-6-[4-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinolin-6-yl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline.
| Compound Name | 4-phenyl-6-[4-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinolin-6-yl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline |
|---|---|
| PubChem CID | 58789449 |
| Molecular Formula | C54H50B2N2O4 |
| Molecular Weight | 812.63 g/mol |
| Exact Mass | 812.40 |
| IUPAC Name | 4-phenyl-6-[4-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinolin-6-yl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline |
| SMILES | CC1(C)OB(c2ccc(-c3cc(-c4ccccc4)c4cc(-c5ccc6nc(-c7ccc(B8OC(C)(C)C(C)(C)O8)cc7)cc(-c7ccccc7)c6c5)ccc4n3)cc2)OC1(C)C |
| InChI | InChI=1S/C54H50B2N2O4/c1-51(2)52(3,4)60-55(59-51)41-25-19-37(20-26-41)49-33-43(35-15-11-9-12-16-35)45-31-39(23-29-47(45)57-49)40-24-30-48-46(32-40)44(36-17-13-10-14-18-36)34-50(58-48)38-21-27-42(28-22-38)56-61-53(5,6)54(7,8)62-56/h9-34H,1-8H3 |
| InChIKey | YFGXPJBDFNHDSB-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.63 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|