C21H23BN2O2 — CID 66800865
3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine (PubChem CID 66800865) has the molecular formula C21H23BN2O2 and a molecular weight of 346.24 g/mol. Its IUPAC name is 3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine.
| Compound Name | 3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 66800865 |
| Molecular Formula | C21H23BN2O2 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine |
| SMILES | CC1(C)OB(c2ccc3nc(N)c(-c4ccccc4)cc3c2)OC1(C)C |
| InChI | InChI=1S/C21H23BN2O2/c1-20(2)21(3,4)26-22(25-20)16-10-11-18-15(12-16)13-17(19(23)24-18)14-8-6-5-7-9-14/h5-13H,1-4H3,(H2,23,24) |
| InChIKey | QUSYATLQWHLOOG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|