C17H21BN2O2 — CID 157047687
6-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 157047687) has the molecular formula C17H21BN2O2 and a molecular weight of 296.18 g/mol. Its IUPAC name is 6-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 6-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 157047687 |
| Molecular Formula | C17H21BN2O2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 6-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2cc(N)nc(-c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C17H21BN2O2/c1-16(2)17(3,4)22-18(21-16)13-10-14(20-15(19)11-13)12-8-6-5-7-9-12/h5-11H,1-4H3,(H2,19,20) |
| InChIKey | DAQKJQRDLXFEBC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|