C60H48BBr2IN2O2 — CID 158961284
1-bromo-3-iodobenzene;2-[3-(3-bromophenyl)phenyl]-4-phenylquinoline;4-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline (PubChem CID 158961284) has the molecular formula C60H48BBr2IN2O2 and a molecular weight of 1126.58 g/mol. Its IUPAC name is 1-bromo-3-iodobenzene;2-[3-(3-bromophenyl)phenyl]-4-phenylquinoline;4-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline.
| Compound Name | 1-bromo-3-iodobenzene;2-[3-(3-bromophenyl)phenyl]-4-phenylquinoline;4-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline |
|---|---|
| PubChem CID | 158961284 |
| Molecular Formula | C60H48BBr2IN2O2 |
| Molecular Weight | 1126.58 g/mol |
| Exact Mass | 1124.12 |
| IUPAC Name | 1-bromo-3-iodobenzene;2-[3-(3-bromophenyl)phenyl]-4-phenylquinoline;4-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline |
| SMILES | Brc1cccc(-c2cccc(-c3cc(-c4ccccc4)c4ccccc4n3)c2)c1.Brc1cccc(I)c1.CC1(C)OB(c2cccc(-c3cc(-c4ccccc4)c4ccccc4n3)c2)OC1(C)C |
| InChI | InChI=1S/C27H26BNO2.C27H18BrN.C6H4BrI/c1-26(2)27(3,4)31-28(30-26)21-14-10-13-20(17-21)25-18-23(19-11-6-5-7-12-19)22-15-8-9-16-24(22)29-25;28-23-13-7-11-21(17-23)20-10-6-12-22(16-20)27-18-25(19-8-2-1-3-9-19)24-14-4-5-15-26(24)29-27;7-5-2-1-3-6(8)4-5/h5-18H,1-4H3;1-18H;1-4H |
| InChIKey | JMQSFHRVOTZUJG-UHFFFAOYSA-N |
| XLogP | 16.92 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1126.58 |
| LogP ≤ 5 | 16.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|