C30H27BN4O2 — CID 140797039
3-[4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]isoquinoline (PubChem CID 140797039) has the molecular formula C30H27BN4O2 and a molecular weight of 486.38 g/mol. Its IUPAC name is 3-[4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]isoquinoline.
| Compound Name | 3-[4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]isoquinoline |
|---|---|
| PubChem CID | 140797039 |
| Molecular Formula | C30H27BN4O2 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 3-[4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]isoquinoline |
| SMILES | CC1(C)OB(c2ccc(-c3nc(-c4ccccc4)nc(-c4cc5ccccc5cn4)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C30H27BN4O2/c1-29(2)30(3,4)37-31(36-29)24-16-14-21(15-17-24)27-33-26(20-10-6-5-7-11-20)34-28(35-27)25-18-22-12-8-9-13-23(22)19-32-25/h5-19H,1-4H3 |
| InChIKey | GDUXOWRMRCQBTI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|