C31H28BN3O2 — CID 140838872
4-phenyl-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]quinazoline (PubChem CID 140838872) has the molecular formula C31H28BN3O2 and a molecular weight of 485.40 g/mol. Its IUPAC name is 4-phenyl-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]quinazoline.
| Compound Name | 4-phenyl-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]quinazoline |
|---|---|
| PubChem CID | 140838872 |
| Molecular Formula | C31H28BN3O2 |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 4-phenyl-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]quinazoline |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4nc(-c5ccccc5)c5ccccc5n4)cn3)cc2)OC1(C)C |
| InChI | InChI=1S/C31H28BN3O2/c1-30(2)31(3,4)37-32(36-30)24-17-14-21(15-18-24)26-19-16-23(20-33-26)29-34-27-13-9-8-12-25(27)28(35-29)22-10-6-5-7-11-22/h5-20H,1-4H3 |
| InChIKey | ACYSDTQVXFELOY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|