C23H24 — CID 144938731
9,9-dimethyl-4-phenylfluorene;ethane (PubChem CID 144938731) has the molecular formula C23H24 and a molecular weight of 300.45 g/mol. Its IUPAC name is 9,9-dimethyl-4-phenylfluorene;ethane.
| Compound Name | 9,9-dimethyl-4-phenylfluorene;ethane |
|---|---|
| PubChem CID | 144938731 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 9,9-dimethyl-4-phenylfluorene;ethane |
| SMILES | CC.CC1(C)c2ccccc2-c2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C21H18.C2H6/c1-21(2)18-13-7-6-11-17(18)20-16(12-8-14-19(20)21)15-9-4-3-5-10-15;1-2/h3-14H,1-2H3;1-2H3 |
| InChIKey | CCWOFDDCKNLBTL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |