C48H45BO2 — CID 145436463
2-[3-[3-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 145436463) has the molecular formula C48H45BO2 and a molecular weight of 664.70 g/mol. Its IUPAC name is 2-[3-[3-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-[3-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145436463 |
| Molecular Formula | C48H45BO2 |
| Molecular Weight | 664.70 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | 2-[3-[3-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5cccc(-c6cccc(B7OC(C)(C)C(C)(C)O7)c6)c5)ccc3-4)cc21 |
| InChI | InChI=1S/C48H45BO2/c1-45(2)41-18-10-9-17-37(41)38-22-20-34(28-42(38)45)35-21-24-40-39-23-19-33(27-43(39)46(3,4)44(40)29-35)31-14-11-13-30(25-31)32-15-12-16-36(26-32)49-50-47(5,6)48(7,8)51-49/h9-29H,1-8H3 |
| InChIKey | XSUCPISMUHWOKO-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.70 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|