C22H21BF2O2 — CID 153474188
2-[4-(2,6-difluorophenyl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 153474188) has the molecular formula C22H21BF2O2 and a molecular weight of 366.22 g/mol. Its IUPAC name is 2-[4-(2,6-difluorophenyl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(2,6-difluorophenyl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 153474188 |
| Molecular Formula | C22H21BF2O2 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[4-(2,6-difluorophenyl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3c(F)cccc3F)c3ccccc23)OC1(C)C |
| InChI | InChI=1S/C22H21BF2O2/c1-21(2)22(3,4)27-23(26-21)17-13-12-16(14-8-5-6-9-15(14)17)20-18(24)10-7-11-19(20)25/h5-13H,1-4H3 |
| InChIKey | BLBXZPJFQUBRRC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|