C18H21BF3NO2 — CID 145001752
2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethanamine (PubChem CID 145001752) has the molecular formula C18H21BF3NO2 and a molecular weight of 351.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethanamine.
| Compound Name | 2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethanamine |
|---|---|
| PubChem CID | 145001752 |
| Molecular Formula | C18H21BF3NO2 |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]ethanamine |
| SMILES | CC1(C)OB(c2ccc(C(N)C(F)(F)F)c3ccccc23)OC1(C)C |
| InChI | InChI=1S/C18H21BF3NO2/c1-16(2)17(3,4)25-19(24-16)14-10-9-13(15(23)18(20,21)22)11-7-5-6-8-12(11)14/h5-10,15H,23H2,1-4H3 |
| InChIKey | PZESFHQKYCDROX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|