C20H29BN2O2 — CID 56924972
1-N,1-N,8-N,8-N-tetramethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1,8-diamine (PubChem CID 56924972) has the molecular formula C20H29BN2O2 and a molecular weight of 340.28 g/mol. Its IUPAC name is 1-N,1-N,8-N,8-N-tetramethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1,8-diamine.
| Compound Name | 1-N,1-N,8-N,8-N-tetramethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1,8-diamine |
|---|---|
| PubChem CID | 56924972 |
| Molecular Formula | C20H29BN2O2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 1-N,1-N,8-N,8-N-tetramethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1,8-diamine |
| SMILES | CN(C)c1cccc2c(B3OC(C)(C)C(C)(C)O3)ccc(N(C)C)c12 |
| InChI | InChI=1S/C20H29BN2O2/c1-19(2)20(3,4)25-21(24-19)15-12-13-17(23(7)8)18-14(15)10-9-11-16(18)22(5)6/h9-13H,1-8H3 |
| InChIKey | UZMCPFJMJXNJKP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|