C30H30B2O4 — CID 144746268
2-[10-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)perylen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 144746268) has the molecular formula C30H30B2O4 and a molecular weight of 476.19 g/mol. Its IUPAC name is 2-[10-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)perylen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[10-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)perylen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144746268 |
| Molecular Formula | C30H30B2O4 |
| Molecular Weight | 476.19 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-[10-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)perylen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1OB(c2ccc3c4ccc(B5OC(C)(C)C(C)(C)O5)c5cccc(c6cccc2c63)c54)OC1C |
| InChI | InChI=1S/C30H30B2O4/c1-17-18(2)34-31(33-17)25-15-13-21-22-14-16-26(32-35-29(3,4)30(5,6)36-32)24-12-8-10-20(28(22)24)19-9-7-11-23(25)27(19)21/h7-18H,1-6H3 |
| InChIKey | RQQHOCPPYPFXEU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.19 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|