C15H24BFO3Si — CID 167737077
[2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-trimethylsilane (PubChem CID 167737077) has the molecular formula C15H24BFO3Si and a molecular weight of 310.25 g/mol. Its IUPAC name is [2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-trimethylsilane.
| Compound Name | [2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-trimethylsilane |
|---|---|
| PubChem CID | 167737077 |
| Molecular Formula | C15H24BFO3Si |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-trimethylsilane |
| SMILES | CC1(C)OB(c2cccc(F)c2O[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C15H24BFO3Si/c1-14(2)15(3,4)20-16(19-14)11-9-8-10-12(17)13(11)18-21(5,6)7/h8-10H,1-7H3 |
| InChIKey | GMLRADNJSZTMAC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|