C14H18BFO3 — CID 100913450
1-[2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (PubChem CID 100913450) has the molecular formula C14H18BFO3 and a molecular weight of 264.10 g/mol. Its IUPAC name is 1-[2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone.
| Compound Name | 1-[2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 100913450 |
| Molecular Formula | C14H18BFO3 |
| Molecular Weight | 264.10 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-[2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| SMILES | CC(=O)c1c(F)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H18BFO3/c1-9(17)12-10(7-6-8-11(12)16)15-18-13(2,3)14(4,5)19-15/h6-8H,1-5H3 |
| InChIKey | XYQPXRJTCTWLAZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.10 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|