C15H18BFO4 — CID 75487324
(E)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid (PubChem CID 75487324) has the molecular formula C15H18BFO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 75487324 |
| Molecular Formula | C15H18BFO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (E)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid |
| SMILES | CC1(C)OB(c2ccc(/C=C/C(=O)O)cc2F)OC1(C)C |
| InChI | InChI=1S/C15H18BFO4/c1-14(2)15(3,4)21-16(20-14)11-7-5-10(9-12(11)17)6-8-13(18)19/h5-9H,1-4H3,(H,18,19)/b8-6+ |
| InChIKey | ZMYGZKCKRSZKQD-SOFGYWHQSA-N |
| XLogP | 2.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|