C16H20BClO4 — CID 169110043
methyl (E)-3-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate (PubChem CID 169110043) has the molecular formula C16H20BClO4 and a molecular weight of 322.60 g/mol. Its IUPAC name is methyl (E)-3-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 169110043 |
| Molecular Formula | C16H20BClO4 |
| Molecular Weight | 322.60 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | methyl (E)-3-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(B2OC(C)(C)C(C)(C)O2)c(Cl)c1 |
| InChI | InChI=1S/C16H20BClO4/c1-15(2)16(3,4)22-17(21-15)12-8-6-11(10-13(12)18)7-9-14(19)20-5/h6-10H,1-5H3/b9-7+ |
| InChIKey | ZRFOARHGIBFQDO-VQHVLOKHSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|