C27H39BClNO6 — CID 66702204
(2S)-5-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (PubChem CID 66702204) has the molecular formula C27H39BClNO6 and a molecular weight of 519.88 g/mol. Its IUPAC name is (2S)-5-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid.
| Compound Name | (2S)-5-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
|---|---|
| PubChem CID | 66702204 |
| Molecular Formula | C27H39BClNO6 |
| Molecular Weight | 519.88 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | (2S)-5-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@](CC=Cc1ccc(B2OC(C)(C)C(C)(C)O2)c(Cl)c1)(C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C27H39BClNO6/c1-24(2,3)34-23(33)30-27(22(31)32,19-12-8-9-13-19)16-10-11-18-14-15-20(21(29)17-18)28-35-25(4,5)26(6,7)36-28/h10-11,14-15,17,19H,8-9,12-13,16H2,1-7H3,(H,30,33)(H,31,32)/t27-/m0/s1 |
| InChIKey | FTSUEVWULIOPDX-MHZLTWQESA-N |
| XLogP | 5.58 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.88 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|