C20H29BFNO4 — CID 140875269
tert-butyl N-[(1R)-7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 140875269) has the molecular formula C20H29BFNO4 and a molecular weight of 377.27 g/mol. Its IUPAC name is tert-butyl N-[(1R)-7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R)-7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 140875269 |
| Molecular Formula | C20H29BFNO4 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | tert-butyl N-[(1R)-7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCc2c(B3OC(C)(C)C(C)(C)O3)ccc(F)c21 |
| InChI | InChI=1S/C20H29BFNO4/c1-18(2,3)25-17(24)23-15-11-8-12-13(9-10-14(22)16(12)15)21-26-19(4,5)20(6,7)27-21/h9-10,15H,8,11H2,1-7H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | RDEGDIFUNMYTEN-OAHLLOKOSA-N |
| XLogP | 3.64 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|