C20H29BFNO4 — CID 172645418
tert-butyl 3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidine-1-carboxylate (PubChem CID 172645418) has the molecular formula C20H29BFNO4 and a molecular weight of 377.27 g/mol. Its IUPAC name is tert-butyl 3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 172645418 |
| Molecular Formula | C20H29BFNO4 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | tert-butyl 3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc(B3OC(C)(C)C(C)(C)O3)c(F)c2)C1 |
| InChI | InChI=1S/C20H29BFNO4/c1-18(2,3)25-17(24)23-11-14(12-23)13-8-9-15(16(22)10-13)21-26-19(4,5)20(6,7)27-21/h8-10,14H,11-12H2,1-7H3 |
| InChIKey | DLIPNDIWNBKZBD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|