C25H34BFN2O4 — CID 172570030
tert-butyl (5R)-5-ethynyl-7-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,7-diazaspiro[2.5]octane-4-carboxylate (PubChem CID 172570030) has the molecular formula C25H34BFN2O4 and a molecular weight of 456.37 g/mol. Its IUPAC name is tert-butyl (5R)-5-ethynyl-7-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,7-diazaspiro[2.5]octane-4-carboxylate.
| Compound Name | tert-butyl (5R)-5-ethynyl-7-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,7-diazaspiro[2.5]octane-4-carboxylate |
|---|---|
| PubChem CID | 172570030 |
| Molecular Formula | C25H34BFN2O4 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | tert-butyl (5R)-5-ethynyl-7-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,7-diazaspiro[2.5]octane-4-carboxylate |
| SMILES | C#C[C@@H]1CN(c2ccc(B3OC(C)(C)C(C)(C)O3)c(F)c2)CC2(CC2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34BFN2O4/c1-9-17-15-28(16-25(12-13-25)29(17)21(30)31-22(2,3)4)18-10-11-19(20(27)14-18)26-32-23(5,6)24(7,8)33-26/h1,10-11,14,17H,12-13,15-16H2,2-8H3/t17-/m1/s1 |
| InChIKey | CWYRJFPWNSOMOU-QGZVFWFLSA-N |
| XLogP | 3.72 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|