C16H22BFN2O4 — CID 70917959
(5S)-5-(aminomethyl)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 70917959) has the molecular formula C16H22BFN2O4 and a molecular weight of 336.17 g/mol. Its IUPAC name is (5S)-5-(aminomethyl)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(aminomethyl)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70917959 |
| Molecular Formula | C16H22BFN2O4 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (5S)-5-(aminomethyl)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OB(c2ccc(N3C[C@H](CN)OC3=O)cc2F)OC1(C)C |
| InChI | InChI=1S/C16H22BFN2O4/c1-15(2)16(3,4)24-17(23-15)12-6-5-10(7-13(12)18)20-9-11(8-19)22-14(20)21/h5-7,11H,8-9,19H2,1-4H3/t11-/m0/s1 |
| InChIKey | IRJAVCJIEHGZSN-NSHDSACASA-N |
| XLogP | 1.41 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|