C10H12FN3O2 — CID 77423554
3-(4-amino-3-fluorophenyl)-5-(aminomethyl)-1,3-oxazolidin-2-one (PubChem CID 77423554) has the molecular formula C10H12FN3O2 and a molecular weight of 225.22 g/mol. Its IUPAC name is 3-(4-amino-3-fluorophenyl)-5-(aminomethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(4-amino-3-fluorophenyl)-5-(aminomethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 77423554 |
| Molecular Formula | C10H12FN3O2 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-(4-amino-3-fluorophenyl)-5-(aminomethyl)-1,3-oxazolidin-2-one |
| SMILES | NCC1CN(c2ccc(N)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C10H12FN3O2/c11-8-3-6(1-2-9(8)13)14-5-7(4-12)16-10(14)15/h1-3,7H,4-5,12-13H2 |
| InChIKey | XJBPYVCFFIIHOI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|