C10H10FN3O3 — CID 142879110
3-(4-amino-3-fluorophenyl)-5-(nitrosomethyl)-1,3-oxazolidin-2-one (PubChem CID 142879110) has the molecular formula C10H10FN3O3 and a molecular weight of 239.21 g/mol. Its IUPAC name is 3-(4-amino-3-fluorophenyl)-5-(nitrosomethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(4-amino-3-fluorophenyl)-5-(nitrosomethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142879110 |
| Molecular Formula | C10H10FN3O3 |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(4-amino-3-fluorophenyl)-5-(nitrosomethyl)-1,3-oxazolidin-2-one |
| SMILES | Nc1ccc(N2CC(CN=O)OC2=O)cc1F |
| InChI | InChI=1S/C10H10FN3O3/c11-8-3-6(1-2-9(8)12)14-5-7(4-13-16)17-10(14)15/h1-3,7H,4-5,12H2 |
| InChIKey | HTOPPDIMZFYKHH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|